C31H40N6O2 — CID 156768559
methyl 6-[4-[7-[3,5-dimethyl-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]hexanoate (PubChem CID 156768559) has the molecular formula C31H40N6O2 and a molecular weight of 528.70 g/mol. Its IUPAC name is methyl 6-[4-[7-[3,5-dimethyl-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]hexanoate.
| Compound Name | methyl 6-[4-[7-[3,5-dimethyl-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]hexanoate |
|---|---|
| PubChem CID | 156768559 |
| Molecular Formula | C31H40N6O2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | methyl 6-[4-[7-[3,5-dimethyl-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]hexanoate |
| SMILES | COC(=O)CCCCCn1cc(-c2cnc3ccc(N(CCNC(C)C)c4cc(C)cc(C)c4)cc3n2)cn1 |
| InChI | InChI=1S/C31H40N6O2/c1-22(2)32-12-14-37(27-16-23(3)15-24(4)17-27)26-10-11-28-29(18-26)35-30(20-33-28)25-19-34-36(21-25)13-8-6-7-9-31(38)39-5/h10-11,15-22,32H,6-9,12-14H2,1-5H3 |
| InChIKey | QVYRNNDRPLAGPC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|