C33H44N6O4 — CID 153180333
tert-butyl 5-[4-[7-[3,5-dimethoxy-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]pentanoate (PubChem CID 153180333) has the molecular formula C33H44N6O4 and a molecular weight of 588.75 g/mol. Its IUPAC name is tert-butyl 5-[4-[7-[3,5-dimethoxy-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]pentanoate.
| Compound Name | tert-butyl 5-[4-[7-[3,5-dimethoxy-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 153180333 |
| Molecular Formula | C33H44N6O4 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.34 |
| IUPAC Name | tert-butyl 5-[4-[7-[3,5-dimethoxy-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]pentanoate |
| SMILES | COc1cc(OC)cc(N(CCNC(C)C)c2ccc3ncc(-c4cnn(CCCCC(=O)OC(C)(C)C)c4)nc3c2)c1 |
| InChI | InChI=1S/C33H44N6O4/c1-23(2)34-13-15-39(26-16-27(41-6)19-28(17-26)42-7)25-11-12-29-30(18-25)37-31(21-35-29)24-20-36-38(22-24)14-9-8-10-32(40)43-33(3,4)5/h11-12,16-23,34H,8-10,13-15H2,1-7H3 |
| InChIKey | WGAPVRSQEKQTLY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|