C32H35N7O3 — CID 175120715
N-(2-aminophenyl)-5-[4-[7-(N-ethyl-3,5-dimethoxyanilino)quinoxalin-2-yl]pyrazol-1-yl]pentanamide (PubChem CID 175120715) has the molecular formula C32H35N7O3 and a molecular weight of 565.68 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[4-[7-(N-ethyl-3,5-dimethoxyanilino)quinoxalin-2-yl]pyrazol-1-yl]pentanamide.
| Compound Name | N-(2-aminophenyl)-5-[4-[7-(N-ethyl-3,5-dimethoxyanilino)quinoxalin-2-yl]pyrazol-1-yl]pentanamide |
|---|---|
| PubChem CID | 175120715 |
| Molecular Formula | C32H35N7O3 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | N-(2-aminophenyl)-5-[4-[7-(N-ethyl-3,5-dimethoxyanilino)quinoxalin-2-yl]pyrazol-1-yl]pentanamide |
| SMILES | CCN(c1cc(OC)cc(OC)c1)c1ccc2ncc(-c3cnn(CCCCC(=O)Nc4ccccc4N)c3)nc2c1 |
| InChI | InChI=1S/C32H35N7O3/c1-4-39(24-15-25(41-2)18-26(16-24)42-3)23-12-13-29-30(17-23)36-31(20-34-29)22-19-35-38(21-22)14-8-7-11-32(40)37-28-10-6-5-9-27(28)33/h5-6,9-10,12-13,15-21H,4,7-8,11,14,33H2,1-3H3,(H,37,40) |
| InChIKey | CFGATPGTEUWWMX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|