C14H8F3N3O — CID 156769369
2-[3-(trifluoromethyl)phenyl]-6H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 156769369) has the molecular formula C14H8F3N3O and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-6H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-6H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 156769369 |
| Molecular Formula | C14H8F3N3O |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-6H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=C1CC=c2cnc(-c3cccc(C(F)(F)F)c3)nc2=N1 |
| InChI | InChI=1S/C14H8F3N3O/c15-14(16,17)10-3-1-2-8(6-10)12-18-7-9-4-5-11(21)19-13(9)20-12/h1-4,6-7H,5H2 |
| InChIKey | YISLPNRQBAQOMQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |