C22H25FN6O2 — CID 156770167
1-[5-fluoro-7-(1-pyridin-3-ylethylamino)quinazolin-2-yl]-3-(oxan-4-ylmethyl)urea (PubChem CID 156770167) has the molecular formula C22H25FN6O2 and a molecular weight of 424.48 g/mol. Its IUPAC name is 1-[5-fluoro-7-(1-pyridin-3-ylethylamino)quinazolin-2-yl]-3-(oxan-4-ylmethyl)urea.
| Compound Name | 1-[5-fluoro-7-(1-pyridin-3-ylethylamino)quinazolin-2-yl]-3-(oxan-4-ylmethyl)urea |
|---|---|
| PubChem CID | 156770167 |
| Molecular Formula | C22H25FN6O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-[5-fluoro-7-(1-pyridin-3-ylethylamino)quinazolin-2-yl]-3-(oxan-4-ylmethyl)urea |
| SMILES | CC(Nc1cc(F)c2cnc(NC(=O)NCC3CCOCC3)nc2c1)c1cccnc1 |
| InChI | InChI=1S/C22H25FN6O2/c1-14(16-3-2-6-24-12-16)27-17-9-19(23)18-13-25-21(28-20(18)10-17)29-22(30)26-11-15-4-7-31-8-5-15/h2-3,6,9-10,12-15,27H,4-5,7-8,11H2,1H3,(H2,25,26,28,29,30) |
| InChIKey | AGEALXNSUKNESU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |