C21H24N6S — CID 156770181
1-cyclopentyl-3-[7-(1-pyridin-3-ylethylamino)quinazolin-2-yl]thiourea (PubChem CID 156770181) has the molecular formula C21H24N6S and a molecular weight of 392.53 g/mol. Its IUPAC name is 1-cyclopentyl-3-[7-(1-pyridin-3-ylethylamino)quinazolin-2-yl]thiourea.
| Compound Name | 1-cyclopentyl-3-[7-(1-pyridin-3-ylethylamino)quinazolin-2-yl]thiourea |
|---|---|
| PubChem CID | 156770181 |
| Molecular Formula | C21H24N6S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-cyclopentyl-3-[7-(1-pyridin-3-ylethylamino)quinazolin-2-yl]thiourea |
| SMILES | CC(Nc1ccc2cnc(NC(=S)NC3CCCC3)nc2c1)c1cccnc1 |
| InChI | InChI=1S/C21H24N6S/c1-14(15-5-4-10-22-12-15)24-18-9-8-16-13-23-20(26-19(16)11-18)27-21(28)25-17-6-2-3-7-17/h4-5,8-14,17,24H,2-3,6-7H2,1H3,(H2,23,25,26,27,28) |
| InChIKey | CWSIXNLHVXEPHC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|