C21H22F3NO6S — CID 156773998
benzyl (2S,4S)-2-(methylsulfonyloxymethyl)-4-[4-(trifluoromethyl)phenoxy]pyrrolidine-1-carboxylate (PubChem CID 156773998) has the molecular formula C21H22F3NO6S and a molecular weight of 473.47 g/mol. Its IUPAC name is benzyl (2S,4S)-2-(methylsulfonyloxymethyl)-4-[4-(trifluoromethyl)phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,4S)-2-(methylsulfonyloxymethyl)-4-[4-(trifluoromethyl)phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156773998 |
| Molecular Formula | C21H22F3NO6S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | benzyl (2S,4S)-2-(methylsulfonyloxymethyl)-4-[4-(trifluoromethyl)phenoxy]pyrrolidine-1-carboxylate |
| SMILES | CS(=O)(=O)OC[C@@H]1C[C@H](Oc2ccc(C(F)(F)F)cc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H22F3NO6S/c1-32(27,28)30-14-17-11-19(31-18-9-7-16(8-10-18)21(22,23)24)12-25(17)20(26)29-13-15-5-3-2-4-6-15/h2-10,17,19H,11-14H2,1H3/t17-,19-/m0/s1 |
| InChIKey | GMFZDDACCLWJKM-HKUYNNGSSA-N |
| XLogP | 3.84 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|