C21H31NO11S2 — CID 57247090
benzyl (2S,4R)-2-[(4-ethoxy-2-methylsulfonyloxy-4-oxobutoxy)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 57247090) has the molecular formula C21H31NO11S2 and a molecular weight of 537.61 g/mol. Its IUPAC name is benzyl (2S,4R)-2-[(4-ethoxy-2-methylsulfonyloxy-4-oxobutoxy)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,4R)-2-[(4-ethoxy-2-methylsulfonyloxy-4-oxobutoxy)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57247090 |
| Molecular Formula | C21H31NO11S2 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | benzyl (2S,4R)-2-[(4-ethoxy-2-methylsulfonyloxy-4-oxobutoxy)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)CC(COC[C@@H]1C[C@@H](OS(C)(=O)=O)CN1C(=O)OCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C21H31NO11S2/c1-4-30-20(23)11-19(33-35(3,27)28)15-29-14-17-10-18(32-34(2,25)26)12-22(17)21(24)31-13-16-8-6-5-7-9-16/h5-9,17-19H,4,10-15H2,1-3H3/t17-,18+,19?/m0/s1 |
| InChIKey | VAVJYCIBIRPHTN-PAMZHZACSA-N |
| XLogP | 1.06 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|