C16H13NOSe — CID 156775583
6,13a-dihydro-5H-isoquinolino[1,2-b][1,3]benzoselenazin-8-one (PubChem CID 156775583) has the molecular formula C16H13NOSe and a molecular weight of 314.25 g/mol. Its IUPAC name is 6,13a-dihydro-5H-isoquinolino[1,2-b][1,3]benzoselenazin-8-one.
| Compound Name | 6,13a-dihydro-5H-isoquinolino[1,2-b][1,3]benzoselenazin-8-one |
|---|---|
| PubChem CID | 156775583 |
| Molecular Formula | C16H13NOSe |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 6,13a-dihydro-5H-isoquinolino[1,2-b][1,3]benzoselenazin-8-one |
| SMILES | O=C1c2ccccc2[Se]C2c3ccccc3CCN12 |
| InChI | InChI=1S/C16H13NOSe/c18-15-13-7-3-4-8-14(13)19-16-12-6-2-1-5-11(12)9-10-17(15)16/h1-8,16H,9-10H2 |
| InChIKey | DYLTZIGLVBGNCX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|