C22H21N3 — CID 156775599
2-[(4S)-4-benzyl-1-phenyl-4,5-dihydroimidazol-2-yl]aniline (PubChem CID 156775599) has the molecular formula C22H21N3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[(4S)-4-benzyl-1-phenyl-4,5-dihydroimidazol-2-yl]aniline.
| Compound Name | 2-[(4S)-4-benzyl-1-phenyl-4,5-dihydroimidazol-2-yl]aniline |
|---|---|
| PubChem CID | 156775599 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-[(4S)-4-benzyl-1-phenyl-4,5-dihydroimidazol-2-yl]aniline |
| SMILES | Nc1ccccc1C1=N[C@@H](Cc2ccccc2)CN1c1ccccc1 |
| InChI | InChI=1S/C22H21N3/c23-21-14-8-7-13-20(21)22-24-18(15-17-9-3-1-4-10-17)16-25(22)19-11-5-2-6-12-19/h1-14,18H,15-16,23H2/t18-/m0/s1 |
| InChIKey | DHJKNEDFUCUITA-SFHVURJKSA-N |
| XLogP | 4.15 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|