C24H27NO3 — CID 156776250
4-(N-cyclobutyl-3,5-dicyclopropylanilino)-3-methoxybenzoic acid (PubChem CID 156776250) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 4-(N-cyclobutyl-3,5-dicyclopropylanilino)-3-methoxybenzoic acid.
| Compound Name | 4-(N-cyclobutyl-3,5-dicyclopropylanilino)-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 156776250 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 4-(N-cyclobutyl-3,5-dicyclopropylanilino)-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1N(c1cc(C2CC2)cc(C2CC2)c1)C1CCC1 |
| InChI | InChI=1S/C24H27NO3/c1-28-23-14-17(24(26)27)9-10-22(23)25(20-3-2-4-20)21-12-18(15-5-6-15)11-19(13-21)16-7-8-16/h9-16,20H,2-8H2,1H3,(H,26,27) |
| InChIKey | WLUCIIWCZVWAOZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |