C10H16O3 — CID 156776745
1,2,3-tris(ethenoxy)butane (PubChem CID 156776745) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 1,2,3-tris(ethenoxy)butane.
| Compound Name | 1,2,3-tris(ethenoxy)butane |
|---|---|
| PubChem CID | 156776745 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1,2,3-tris(ethenoxy)butane |
| SMILES | C=COCC(OC=C)C(C)OC=C |
| InChI | InChI=1S/C10H16O3/c1-5-11-8-10(13-7-3)9(4)12-6-2/h5-7,9-10H,1-3,8H2,4H3 |
| InChIKey | GNNLWRVTXPJDPO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|