C15H21N3O3S — CID 156777092
tert-butyl (1S,9S)-4-methylsulfanyl-6-oxo-3,5,11-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-11-carboxylate (PubChem CID 156777092) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is tert-butyl (1S,9S)-4-methylsulfanyl-6-oxo-3,5,11-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-11-carboxylate.
| Compound Name | tert-butyl (1S,9S)-4-methylsulfanyl-6-oxo-3,5,11-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-11-carboxylate |
|---|---|
| PubChem CID | 156777092 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | tert-butyl (1S,9S)-4-methylsulfanyl-6-oxo-3,5,11-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-11-carboxylate |
| SMILES | CSc1nc2c(c(=O)[nH]1)C[C@H]1C[C@@H]2N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H21N3O3S/c1-15(2,3)21-14(20)18-7-8-5-9-11(10(18)6-8)16-13(22-4)17-12(9)19/h8,10H,5-7H2,1-4H3,(H,16,17,19)/t8-,10-/m0/s1 |
| InChIKey | WOYDJKHJHFSWPR-WPRPVWTQSA-N |
| XLogP | 2.35 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |