C18H28N4O5S — CID 156777105
ditert-butyl 2-methylsulfanyl-4-oxo-3,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepine-5,8-dicarboxylate (PubChem CID 156777105) has the molecular formula C18H28N4O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is ditert-butyl 2-methylsulfanyl-4-oxo-3,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepine-5,8-dicarboxylate.
| Compound Name | ditert-butyl 2-methylsulfanyl-4-oxo-3,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepine-5,8-dicarboxylate |
|---|---|
| PubChem CID | 156777105 |
| Molecular Formula | C18H28N4O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | ditert-butyl 2-methylsulfanyl-4-oxo-3,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepine-5,8-dicarboxylate |
| SMILES | CSc1nc2c(c(=O)[nH]1)N(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C18H28N4O5S/c1-17(2,3)26-15(24)21-8-9-22(16(25)27-18(4,5)6)12-11(10-21)19-14(28-7)20-13(12)23/h8-10H2,1-7H3,(H,19,20,23) |
| InChIKey | DNSARVQHYOWLEX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |