C18H32O6 — CID 156777293
2-dodecylperoxyperoxyethenyl 2-methylprop-2-enoate (PubChem CID 156777293) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-dodecylperoxyperoxyethenyl 2-methylprop-2-enoate.
| Compound Name | 2-dodecylperoxyperoxyethenyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 156777293 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 2-dodecylperoxyperoxyethenyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC=COOOOCCCCCCCCCCCC |
| InChI | InChI=1S/C18H32O6/c1-4-5-6-7-8-9-10-11-12-13-14-21-23-24-22-16-15-20-18(19)17(2)3/h15-16H,2,4-14H2,1,3H3 |
| InChIKey | MKLJJBBAFQSEIE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|