C15H19F3N2O3S — CID 156778109
N-[(3R)-1-oxa-8-azaspiro[4.5]decan-3-yl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 156778109) has the molecular formula C15H19F3N2O3S and a molecular weight of 364.39 g/mol. Its IUPAC name is N-[(3R)-1-oxa-8-azaspiro[4.5]decan-3-yl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(3R)-1-oxa-8-azaspiro[4.5]decan-3-yl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 156778109 |
| Molecular Formula | C15H19F3N2O3S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[(3R)-1-oxa-8-azaspiro[4.5]decan-3-yl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1COC2(CCNCC2)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O3S/c16-15(17,18)11-2-1-3-13(8-11)24(21,22)20-12-9-14(23-10-12)4-6-19-7-5-14/h1-3,8,12,19-20H,4-7,9-10H2/t12-/m1/s1 |
| InChIKey | FWDDYRDKGOVYPF-GFCCVEGCSA-N |
| XLogP | 1.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |