C15H9F5O2 — CID 156782366
4-(difluoromethoxy)-3-[(2,4,5-trifluorophenyl)methyl]benzaldehyde (PubChem CID 156782366) has the molecular formula C15H9F5O2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-[(2,4,5-trifluorophenyl)methyl]benzaldehyde.
| Compound Name | 4-(difluoromethoxy)-3-[(2,4,5-trifluorophenyl)methyl]benzaldehyde |
|---|---|
| PubChem CID | 156782366 |
| Molecular Formula | C15H9F5O2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-(difluoromethoxy)-3-[(2,4,5-trifluorophenyl)methyl]benzaldehyde |
| SMILES | O=Cc1ccc(OC(F)F)c(Cc2cc(F)c(F)cc2F)c1 |
| InChI | InChI=1S/C15H9F5O2/c16-11-6-13(18)12(17)5-9(11)4-10-3-8(7-21)1-2-14(10)22-15(19)20/h1-3,5-7,15H,4H2 |
| InChIKey | LWAUNNKTMDXLBF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|