C17H10F8O2 — CID 156782361
3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(difluoromethoxy)benzaldehyde (PubChem CID 156782361) has the molecular formula C17H10F8O2 and a molecular weight of 398.25 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(difluoromethoxy)benzaldehyde.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(difluoromethoxy)benzaldehyde |
|---|---|
| PubChem CID | 156782361 |
| Molecular Formula | C17H10F8O2 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(difluoromethoxy)benzaldehyde |
| SMILES | O=Cc1ccc(OC(F)F)c(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H10F8O2/c18-15(19)27-14-2-1-9(8-26)3-11(14)4-10-5-12(16(20,21)22)7-13(6-10)17(23,24)25/h1-3,5-8,15H,4H2 |
| InChIKey | LHKJOIUQOXDDMZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|