C14H11ClFN5 — CID 156784391
4-chloro-2-(5-fluoro-3-pyridinyl)-7,8,9,10-tetrahydro-[1,3,5]triazino[1,2-b]indazole (PubChem CID 156784391) has the molecular formula C14H11ClFN5 and a molecular weight of 303.73 g/mol. Its IUPAC name is 4-chloro-2-(5-fluoro-3-pyridinyl)-7,8,9,10-tetrahydro-[1,3,5]triazino[1,2-b]indazole.
| Compound Name | 4-chloro-2-(5-fluoro-3-pyridinyl)-7,8,9,10-tetrahydro-[1,3,5]triazino[1,2-b]indazole |
|---|---|
| PubChem CID | 156784391 |
| Molecular Formula | C14H11ClFN5 |
| Molecular Weight | 303.73 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-chloro-2-(5-fluoro-3-pyridinyl)-7,8,9,10-tetrahydro-[1,3,5]triazino[1,2-b]indazole |
| SMILES | Fc1cncc(-c2nc(Cl)n3nc4c(c3n2)CCCC4)c1 |
| InChI | InChI=1S/C14H11ClFN5/c15-14-19-12(8-5-9(16)7-17-6-8)18-13-10-3-1-2-4-11(10)20-21(13)14/h5-7H,1-4H2 |
| InChIKey | SSXDUQXFQKANCE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |