C30H39NO2Si — CID 156786666
(2E)-2-[[3-phenyl-2-[2-tri(propan-2-yl)silylethynyl]phenyl]methoxyimino]cyclohexan-1-one (PubChem CID 156786666) has the molecular formula C30H39NO2Si and a molecular weight of 473.73 g/mol. Its IUPAC name is (2E)-2-[[3-phenyl-2-[2-tri(propan-2-yl)silylethynyl]phenyl]methoxyimino]cyclohexan-1-one.
| Compound Name | (2E)-2-[[3-phenyl-2-[2-tri(propan-2-yl)silylethynyl]phenyl]methoxyimino]cyclohexan-1-one |
|---|---|
| PubChem CID | 156786666 |
| Molecular Formula | C30H39NO2Si |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | (2E)-2-[[3-phenyl-2-[2-tri(propan-2-yl)silylethynyl]phenyl]methoxyimino]cyclohexan-1-one |
| SMILES | CC(C)[Si](C#Cc1c(CO/N=C2\CCCCC2=O)cccc1-c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H39NO2Si/c1-22(2)34(23(3)4,24(5)6)20-19-28-26(21-33-31-29-17-10-11-18-30(29)32)15-12-16-27(28)25-13-8-7-9-14-25/h7-9,12-16,22-24H,10-11,17-18,21H2,1-6H3/b31-29+ |
| InChIKey | RYSNMCSGTLBKRX-OWWNRXNESA-N |
| XLogP | 7.94 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|