C27H39NO3Si — CID 156786669
(2E)-2-[[2-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclohexyl]ethynyl]phenyl]methoxyimino]cyclohexan-1-one (PubChem CID 156786669) has the molecular formula C27H39NO3Si and a molecular weight of 453.70 g/mol. Its IUPAC name is (2E)-2-[[2-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclohexyl]ethynyl]phenyl]methoxyimino]cyclohexan-1-one.
| Compound Name | (2E)-2-[[2-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclohexyl]ethynyl]phenyl]methoxyimino]cyclohexan-1-one |
|---|---|
| PubChem CID | 156786669 |
| Molecular Formula | C27H39NO3Si |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (2E)-2-[[2-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclohexyl]ethynyl]phenyl]methoxyimino]cyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1(C#Cc2ccccc2CO/N=C2\CCCCC2=O)CCCCC1 |
| InChI | InChI=1S/C27H39NO3Si/c1-26(2,3)32(4,5)31-27(18-11-6-12-19-27)20-17-22-13-7-8-14-23(22)21-30-28-24-15-9-10-16-25(24)29/h7-8,13-14H,6,9-12,15-16,18-19,21H2,1-5H3/b28-24+ |
| InChIKey | WXQDMQSNFFMAQN-ZZIIXHQDSA-N |
| XLogP | 6.78 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|