C16H20O3 — CID 156788522
3-ethyl-6-(4-methoxyphenyl)-4-methylidenehex-5-yne-1,3-diol (PubChem CID 156788522) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-ethyl-6-(4-methoxyphenyl)-4-methylidenehex-5-yne-1,3-diol.
| Compound Name | 3-ethyl-6-(4-methoxyphenyl)-4-methylidenehex-5-yne-1,3-diol |
|---|---|
| PubChem CID | 156788522 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-ethyl-6-(4-methoxyphenyl)-4-methylidenehex-5-yne-1,3-diol |
| SMILES | C=C(C#Cc1ccc(OC)cc1)C(O)(CC)CCO |
| InChI | InChI=1S/C16H20O3/c1-4-16(18,11-12-17)13(2)5-6-14-7-9-15(19-3)10-8-14/h7-10,17-18H,2,4,11-12H2,1,3H3 |
| InChIKey | FAQUBTWJITYFHJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|