C15H18OSi — CID 102159100
5-(4-methoxyphenyl)penta-1,2-dien-4-yn-3-yl-trimethylsilane (PubChem CID 102159100) has the molecular formula C15H18OSi and a molecular weight of 242.39 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)penta-1,2-dien-4-yn-3-yl-trimethylsilane.
| Compound Name | 5-(4-methoxyphenyl)penta-1,2-dien-4-yn-3-yl-trimethylsilane |
|---|---|
| PubChem CID | 102159100 |
| Molecular Formula | C15H18OSi |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 5-(4-methoxyphenyl)penta-1,2-dien-4-yn-3-yl-trimethylsilane |
| SMILES | C=C=C(C#Cc1ccc(OC)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C15H18OSi/c1-6-15(17(3,4)5)12-9-13-7-10-14(16-2)11-8-13/h7-8,10-11H,1H2,2-5H3 |
| InChIKey | XEIACWPJOIASBH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|