3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride

C11H11Cl2IO2 — CID 156790203

IUPAC3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride
SMILESO=C(Cl)CCc1ccc(OCCCl)c(I)c1
InChIInChI=1S/C11H11Cl2IO2/c12-5-6-16-10-3-1-8(7-9(10)14)2-4-11(13)15/h1,3,7H,2,4-6H2
InChIKeyBJLPAXQFHNSMBW-UHFFFAOYSA-N
MW373.02 g/mol
LogP3.61
Rot. Bonds6

About 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride

3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride (PubChem CID 156790203) has the molecular formula C11H11Cl2IO2 and a molecular weight of 373.02 g/mol. Its IUPAC name is 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride.

Molecular Properties

Compound Name3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride
PubChem CID156790203
Molecular FormulaC11H11Cl2IO2
Molecular Weight373.02 g/mol
Exact Mass371.92
IUPAC Name3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride
SMILESO=C(Cl)CCc1ccc(OCCCl)c(I)c1
InChIInChI=1S/C11H11Cl2IO2/c12-5-6-16-10-3-1-8(7-9(10)14)2-4-11(13)15/h1,3,7H,2,4-6H2
InChIKeyBJLPAXQFHNSMBW-UHFFFAOYSA-N
XLogP3.61
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500373.02
LogP ≤ 53.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride?
The IUPAC name of 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride (CID 156790203) is 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride.
What is the SMILES notation for 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride?
The canonical SMILES for 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride is O=C(Cl)CCc1ccc(OCCCl)c(I)c1.
What is the InChIKey of 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride?
The InChIKey is BJLPAXQFHNSMBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2IO2/c12-5-6-16-10-3-1-8(7-9(10)14)2-4-11(13)15/h1,3,7H,2,4-6H2.
What are the key properties of 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride?
3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride has a molecular weight of 373.02 g/mol, XLogP of 3.61, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-chloroethoxy)-3-iodophenyl]propanoyl chloride is sourced from PubChem (CID 156790203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).