C17H28O3 — CID 156790369
(2S,3S,6R)-3-methyl-2-prop-2-enyl-6-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]cycloheptan-1-one (PubChem CID 156790369) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (2S,3S,6R)-3-methyl-2-prop-2-enyl-6-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]cycloheptan-1-one.
| Compound Name | (2S,3S,6R)-3-methyl-2-prop-2-enyl-6-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]cycloheptan-1-one |
|---|---|
| PubChem CID | 156790369 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (2S,3S,6R)-3-methyl-2-prop-2-enyl-6-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]cycloheptan-1-one |
| SMILES | C=CC[C@@H]1C(=O)C[C@H]([C@@]2(C)COC(C)(C)O2)CC[C@@H]1C |
| InChI | InChI=1S/C17H28O3/c1-6-7-14-12(2)8-9-13(10-15(14)18)17(5)11-19-16(3,4)20-17/h6,12-14H,1,7-11H2,2-5H3/t12-,13+,14-,17+/m0/s1 |
| InChIKey | VVJSANVVNUKZBT-QDEZUTFSSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|