C13H12F2O5 — CID 156790584
ethyl 3-(difluoromethyl)-5-(hydroxymethylidene)-4-oxo-6,7-dihydro-1-benzofuran-2-carboxylate (PubChem CID 156790584) has the molecular formula C13H12F2O5 and a molecular weight of 286.23 g/mol. Its IUPAC name is ethyl 3-(difluoromethyl)-5-(hydroxymethylidene)-4-oxo-6,7-dihydro-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-(difluoromethyl)-5-(hydroxymethylidene)-4-oxo-6,7-dihydro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 156790584 |
| Molecular Formula | C13H12F2O5 |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | ethyl 3-(difluoromethyl)-5-(hydroxymethylidene)-4-oxo-6,7-dihydro-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2c(c1C(F)F)C(=O)C(=CO)CC2 |
| InChI | InChI=1S/C13H12F2O5/c1-2-19-13(18)11-9(12(14)15)8-7(20-11)4-3-6(5-16)10(8)17/h5,12,16H,2-4H2,1H3 |
| InChIKey | DUWTVAFJAXACJE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|