C16H36Cl2N12O2S2 — CID 156791526
(2R)-2,6-diamino-N-[2-(2-aminoethyldisulfanyl)ethyl]-2-azido-N-[(2R)-2,6-diamino-2-azidohexanoyl]hexanamide;dihydrochloride (PubChem CID 156791526) has the molecular formula C16H36Cl2N12O2S2 and a molecular weight of 563.59 g/mol. Its IUPAC name is (2R)-2,6-diamino-N-[2-(2-aminoethyldisulfanyl)ethyl]-2-azido-N-[(2R)-2,6-diamino-2-azidohexanoyl]hexanamide;dihydrochloride.
| Compound Name | (2R)-2,6-diamino-N-[2-(2-aminoethyldisulfanyl)ethyl]-2-azido-N-[(2R)-2,6-diamino-2-azidohexanoyl]hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 156791526 |
| Molecular Formula | C16H36Cl2N12O2S2 |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | (2R)-2,6-diamino-N-[2-(2-aminoethyldisulfanyl)ethyl]-2-azido-N-[(2R)-2,6-diamino-2-azidohexanoyl]hexanamide;dihydrochloride |
| SMILES | Cl.Cl.[N-]=[N+]=N[C@](N)(CCCCN)C(=O)N(CCSSCCN)C(=O)[C@@](N)(CCCCN)N=[N+]=[N-] |
| InChI | InChI=1S/C16H34N12O2S2.2ClH/c17-7-3-1-5-15(20,24-26-22)13(29)28(10-12-32-31-11-9-19)14(30)16(21,25-27-23)6-2-4-8-18;;/h1-12,17-21H2;2*1H/t15-,16-;;/m1../s1 |
| InChIKey | CBQWDDMPSRPFLK-UWGSCQAASA-N |
| XLogP | 1.71 |
| TPSA | 265.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|