C16H32N2O6S2 — CID 87509378
N-[2-(2-aminoethyldisulfanyl)ethyl]-N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 87509378) has the molecular formula C16H32N2O6S2 and a molecular weight of 412.57 g/mol. Its IUPAC name is N-[2-(2-aminoethyldisulfanyl)ethyl]-N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 87509378 |
| Molecular Formula | C16H32N2O6S2 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)C(O)C(=O)N(CCSSCCN)C(=O)C(O)C(C)(C)CO |
| InChI | InChI=1S/C16H32N2O6S2/c1-15(2,9-19)11(21)13(23)18(6-8-26-25-7-5-17)14(24)12(22)16(3,4)10-20/h11-12,19-22H,5-10,17H2,1-4H3 |
| InChIKey | LJVGXRSPOUHLBC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|