C7H18N2O3S3 — CID 175821762
1-amino-3-(2-aminoethyldisulfanyl)-3-methylbutane-1-sulfonic acid (PubChem CID 175821762) has the molecular formula C7H18N2O3S3 and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-amino-3-(2-aminoethyldisulfanyl)-3-methylbutane-1-sulfonic acid.
| Compound Name | 1-amino-3-(2-aminoethyldisulfanyl)-3-methylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 175821762 |
| Molecular Formula | C7H18N2O3S3 |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-amino-3-(2-aminoethyldisulfanyl)-3-methylbutane-1-sulfonic acid |
| SMILES | CC(C)(CC(N)S(=O)(=O)O)SSCCN |
| InChI | InChI=1S/C7H18N2O3S3/c1-7(2,14-13-4-3-8)5-6(9)15(10,11)12/h6H,3-5,8-9H2,1-2H3,(H,10,11,12) |
| InChIKey | ADHAZHFMUBUQOI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|