C4H11NO3S — CID 123572619
(2S,3R)-3-aminobutane-2-sulfonic acid (PubChem CID 123572619) has the molecular formula C4H11NO3S and a molecular weight of 153.20 g/mol. Its IUPAC name is (2S,3R)-3-aminobutane-2-sulfonic acid.
| Compound Name | (2S,3R)-3-aminobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 123572619 |
| Molecular Formula | C4H11NO3S |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | (2S,3R)-3-aminobutane-2-sulfonic acid |
| SMILES | C[C@@H](N)[C@H](C)S(=O)(=O)O |
| InChI | InChI=1S/C4H11NO3S/c1-3(5)4(2)9(6,7)8/h3-4H,5H2,1-2H3,(H,6,7,8)/t3-,4+/m1/s1 |
| InChIKey | KOVGNLPGOFOHMW-DMTCNVIQSA-N |
| XLogP | -0.39 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|