C6H15NO6S — CID 21248699
1-amino-4-hydroxy-3,3-bis(hydroxymethyl)butane-1-sulfonic acid (PubChem CID 21248699) has the molecular formula C6H15NO6S and a molecular weight of 229.25 g/mol. Its IUPAC name is 1-amino-4-hydroxy-3,3-bis(hydroxymethyl)butane-1-sulfonic acid.
| Compound Name | 1-amino-4-hydroxy-3,3-bis(hydroxymethyl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 21248699 |
| Molecular Formula | C6H15NO6S |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 1-amino-4-hydroxy-3,3-bis(hydroxymethyl)butane-1-sulfonic acid |
| SMILES | NC(CC(CO)(CO)CO)S(=O)(=O)O |
| InChI | InChI=1S/C6H15NO6S/c7-5(14(11,12)13)1-6(2-8,3-9)4-10/h5,8-10H,1-4,7H2,(H,11,12,13) |
| InChIKey | DBEDTBJGEXDPBT-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|