C8H18O18S4 — CID 175440805
2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrasulfopropanoic acid (PubChem CID 175440805) has the molecular formula C8H18O18S4 and a molecular weight of 530.48 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrasulfopropanoic acid.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrasulfopropanoic acid |
|---|---|
| PubChem CID | 175440805 |
| Molecular Formula | C8H18O18S4 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 529.94 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrasulfopropanoic acid |
| SMILES | O=C(O)C(C(S(=O)(=O)O)S(=O)(=O)O)(S(=O)(=O)O)S(=O)(=O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C3H6O14S4/c6-1-5(2-7,3-8)4-9;4-1(5)3(20(12,13)14,21(15,16)17)2(18(6,7)8)19(9,10)11/h6-9H,1-4H2;2H,(H,4,5)(H,6,7,8)(H,9,10,11)(H,12,13,14)(H,15,16,17) |
| InChIKey | KTYCURNUAKMRLI-UHFFFAOYSA-N |
| XLogP | -5.41 |
| TPSA | 335.70 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|