C8H18O6S4 — CID 86747667
2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrakis(sulfanyl)propanoic acid (PubChem CID 86747667) has the molecular formula C8H18O6S4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrakis(sulfanyl)propanoic acid.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrakis(sulfanyl)propanoic acid |
|---|---|
| PubChem CID | 86747667 |
| Molecular Formula | C8H18O6S4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrakis(sulfanyl)propanoic acid |
| SMILES | O=C(O)C(S)(S)C(S)S.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C3H6O2S4/c6-1-5(2-7,3-8)4-9;4-1(5)3(8,9)2(6)7/h6-9H,1-4H2;2,6-9H,(H,4,5) |
| InChIKey | XQLGJSOZVUDHCP-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|