C27H33NO2 — CID 156791735
N-[2-(3-methoxyphenyl)propan-2-yl]-4-(3-phenylmethoxyphenyl)butan-1-amine (PubChem CID 156791735) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)propan-2-yl]-4-(3-phenylmethoxyphenyl)butan-1-amine.
| Compound Name | N-[2-(3-methoxyphenyl)propan-2-yl]-4-(3-phenylmethoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 156791735 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | N-[2-(3-methoxyphenyl)propan-2-yl]-4-(3-phenylmethoxyphenyl)butan-1-amine |
| SMILES | COc1cccc(C(C)(C)NCCCCc2cccc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C27H33NO2/c1-27(2,24-15-10-16-25(20-24)29-3)28-18-8-7-11-22-14-9-17-26(19-22)30-21-23-12-5-4-6-13-23/h4-6,9-10,12-17,19-20,28H,7-8,11,18,21H2,1-3H3 |
| InChIKey | NQULGFTWLWXLGF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|