C38H52BFN4O5 — CID 156792779
tert-butyl 4-[[3-fluoro-4-[1-(oxan-2-yl)-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]indazol-5-yl]phenyl]methyl-methylamino]piperidine-1-carboxylate (PubChem CID 156792779) has the molecular formula C38H52BFN4O5 and a molecular weight of 674.67 g/mol. Its IUPAC name is tert-butyl 4-[[3-fluoro-4-[1-(oxan-2-yl)-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]indazol-5-yl]phenyl]methyl-methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-fluoro-4-[1-(oxan-2-yl)-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]indazol-5-yl]phenyl]methyl-methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156792779 |
| Molecular Formula | C38H52BFN4O5 |
| Molecular Weight | 674.67 g/mol |
| Exact Mass | 674.40 |
| IUPAC Name | tert-butyl 4-[[3-fluoro-4-[1-(oxan-2-yl)-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]indazol-5-yl]phenyl]methyl-methylamino]piperidine-1-carboxylate |
| SMILES | CN(Cc1ccc(-c2ccc3c(c2)c(/C=C/B2OC(C)(C)C(C)(C)O2)nn3C2CCCCO2)c(F)c1)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C38H52BFN4O5/c1-36(2,3)47-35(45)43-20-17-28(18-21-43)42(8)25-26-12-14-29(31(40)23-26)27-13-15-33-30(24-27)32(41-44(33)34-11-9-10-22-46-34)16-19-39-48-37(4,5)38(6,7)49-39/h12-16,19,23-24,28,34H,9-11,17-18,20-22,25H2,1-8H3/b19-16+ |
| InChIKey | UBVPADPABVOREL-KNTRCKAVSA-N |
| XLogP | 8.02 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.67 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|