C8H10ClNO2 — CID 156793944
methyl (E,2E)-4-chloro-2-[(methylideneamino)methylidene]pent-3-enoate (PubChem CID 156793944) has the molecular formula C8H10ClNO2 and a molecular weight of 187.63 g/mol. Its IUPAC name is methyl (E,2E)-4-chloro-2-[(methylideneamino)methylidene]pent-3-enoate.
| Compound Name | methyl (E,2E)-4-chloro-2-[(methylideneamino)methylidene]pent-3-enoate |
|---|---|
| PubChem CID | 156793944 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | methyl (E,2E)-4-chloro-2-[(methylideneamino)methylidene]pent-3-enoate |
| SMILES | C=N/C=C(\C=C(/C)Cl)C(=O)OC |
| InChI | InChI=1S/C8H10ClNO2/c1-6(9)4-7(5-10-2)8(11)12-3/h4-5H,2H2,1,3H3/b6-4+,7-5+ |
| InChIKey | YWAJRIBADWNOOI-YDFGWWAZSA-N |
| XLogP | 1.89 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|