About methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium
methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium (PubChem CID 59876413) has the molecular formula C7H5ClNO2Rf-
and a molecular weight of 437.58 g/mol. Its IUPAC name is methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium.
Molecular Properties
| Compound Name | methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium |
| PubChem CID | 59876413 |
| Molecular Formula | C7H5ClNO2Rf- |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium |
| SMILES | COC(=O)c1[c-]cc(Cl)nc1.[Rf] |
| InChI | InChI=1S/C7H5ClNO2.Rf/c1-11-7(10)5-2-3-6(8)9-4-5;/h3-4H,1H3;/q-1; |
| InChIKey | JOGQTVGXHXMSLR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium?
The IUPAC name of methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium (CID 59876413) is methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium.
What is the SMILES notation for methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium?
The canonical SMILES for methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium is COC(=O)c1[c-]cc(Cl)nc1.[Rf].
What is the InChIKey of methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium?
The InChIKey is JOGQTVGXHXMSLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClNO2.Rf/c1-11-7(10)5-2-3-6(8)9-4-5;/h3-4H,1H3;/q-1;.
What are the key properties of methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium?
methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium has a molecular weight of 437.58 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-4H-pyridin-4-ide-3-carboxylate;rutherfordium is sourced from PubChem (CID 59876413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).