C11H16ClNO2 — CID 168972602
ethyl (E,2E)-2-[(1-chloroethylideneamino)methylidene]hex-3-enoate (PubChem CID 168972602) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is ethyl (E,2E)-2-[(1-chloroethylideneamino)methylidene]hex-3-enoate.
| Compound Name | ethyl (E,2E)-2-[(1-chloroethylideneamino)methylidene]hex-3-enoate |
|---|---|
| PubChem CID | 168972602 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | ethyl (E,2E)-2-[(1-chloroethylideneamino)methylidene]hex-3-enoate |
| SMILES | CC/C=C/C(=C\N=C(/C)Cl)C(=O)OCC |
| InChI | InChI=1S/C11H16ClNO2/c1-4-6-7-10(8-13-9(3)12)11(14)15-5-2/h6-8H,4-5H2,1-3H3/b7-6+,10-8+,13-9+ |
| InChIKey | TXIBJZOJKDCWNL-RFQLGPRVSA-N |
| XLogP | 3.06 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|