C20H41NO4 — CID 156795110
2-methyl-N-[2-[2-[2-[2-(4-methylhex-2-ynoxy)ethoxy]ethoxy]ethoxy]ethyl]butan-1-amine;molecular hydrogen (PubChem CID 156795110) has the molecular formula C20H41NO4 and a molecular weight of 359.55 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-[2-(4-methylhex-2-ynoxy)ethoxy]ethoxy]ethoxy]ethyl]butan-1-amine;molecular hydrogen.
| Compound Name | 2-methyl-N-[2-[2-[2-[2-(4-methylhex-2-ynoxy)ethoxy]ethoxy]ethoxy]ethyl]butan-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 156795110 |
| Molecular Formula | C20H41NO4 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-[2-(4-methylhex-2-ynoxy)ethoxy]ethoxy]ethoxy]ethyl]butan-1-amine;molecular hydrogen |
| SMILES | CCC(C)C#CCOCCOCCOCCOCCNCC(C)CC.[H][H] |
| InChI | InChI=1S/C20H39NO4.H2/c1-5-19(3)8-7-10-22-12-14-24-16-17-25-15-13-23-11-9-21-18-20(4)6-2;/h19-21H,5-6,9-18H2,1-4H3;1H |
| InChIKey | NBTRWTLTHCHHQM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|