C28H42N6O4 — CID 156796274
2-(2,3-dimethoxyphenyl)-N-imino-2-(4-phenylpiperidin-1-yl)ethanimidamide;formic acid;(1-methylpyrrolidin-3-yl)methanamine (PubChem CID 156796274) has the molecular formula C28H42N6O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-N-imino-2-(4-phenylpiperidin-1-yl)ethanimidamide;formic acid;(1-methylpyrrolidin-3-yl)methanamine.
| Compound Name | 2-(2,3-dimethoxyphenyl)-N-imino-2-(4-phenylpiperidin-1-yl)ethanimidamide;formic acid;(1-methylpyrrolidin-3-yl)methanamine |
|---|---|
| PubChem CID | 156796274 |
| Molecular Formula | C28H42N6O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-N-imino-2-(4-phenylpiperidin-1-yl)ethanimidamide;formic acid;(1-methylpyrrolidin-3-yl)methanamine |
| SMILES | CN1CCC(CN)C1.O=CO.[H]/N=C(\N=N\[H])C(c1cccc(OC)c1OC)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N4O2.C6H14N2.CH2O2/c1-26-18-10-6-9-17(20(18)27-2)19(21(22)24-23)25-13-11-16(12-14-25)15-7-4-3-5-8-15;1-8-3-2-6(4-7)5-8;2-1-3/h3-10,16,19,22-23H,11-14H2,1-2H3;6H,2-5,7H2,1H3;1H,(H,2,3)/b22-21-,24-23+;; |
| InChIKey | KUQWDTSAKWGRAN-ZOJTXOBGSA-N |
| XLogP | 4.23 |
| TPSA | 148.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|