C27H42N4O2 — CID 156796118
N-amino-N'-tert-butyl-2-(2,3-dimethoxyphenyl)-2-(4-phenylpiperidin-1-yl)ethanimidamide;ethane (PubChem CID 156796118) has the molecular formula C27H42N4O2 and a molecular weight of 454.66 g/mol. Its IUPAC name is N-amino-N'-tert-butyl-2-(2,3-dimethoxyphenyl)-2-(4-phenylpiperidin-1-yl)ethanimidamide;ethane.
| Compound Name | N-amino-N'-tert-butyl-2-(2,3-dimethoxyphenyl)-2-(4-phenylpiperidin-1-yl)ethanimidamide;ethane |
|---|---|
| PubChem CID | 156796118 |
| Molecular Formula | C27H42N4O2 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | N-amino-N'-tert-butyl-2-(2,3-dimethoxyphenyl)-2-(4-phenylpiperidin-1-yl)ethanimidamide;ethane |
| SMILES | CC.COc1cccc(C(/C(=N/C(C)(C)C)NN)N2CCC(c3ccccc3)CC2)c1OC |
| InChI | InChI=1S/C25H36N4O2.C2H6/c1-25(2,3)27-24(28-26)22(20-12-9-13-21(30-4)23(20)31-5)29-16-14-19(15-17-29)18-10-7-6-8-11-18;1-2/h6-13,19,22H,14-17,26H2,1-5H3,(H,27,28);1-2H3 |
| InChIKey | YAOGCPLLZZUSLC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|