C26H35N5O2S — CID 156796120
N-amino-2-[4-[(Z)-1-amino-3-sulfanylideneprop-1-enyl]piperidin-1-yl]-2-(2,3-dimethoxyphenyl)-N-(2-phenylethyl)ethanimidamide (PubChem CID 156796120) has the molecular formula C26H35N5O2S and a molecular weight of 481.67 g/mol. Its IUPAC name is N-amino-2-[4-[(Z)-1-amino-3-sulfanylideneprop-1-enyl]piperidin-1-yl]-2-(2,3-dimethoxyphenyl)-N-(2-phenylethyl)ethanimidamide.
| Compound Name | N-amino-2-[4-[(Z)-1-amino-3-sulfanylideneprop-1-enyl]piperidin-1-yl]-2-(2,3-dimethoxyphenyl)-N-(2-phenylethyl)ethanimidamide |
|---|---|
| PubChem CID | 156796120 |
| Molecular Formula | C26H35N5O2S |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | N-amino-2-[4-[(Z)-1-amino-3-sulfanylideneprop-1-enyl]piperidin-1-yl]-2-(2,3-dimethoxyphenyl)-N-(2-phenylethyl)ethanimidamide |
| SMILES | [H]/N=C(/C(c1cccc(OC)c1OC)N1CCC(/C(N)=C/C=S)CC1)N(N)CCc1ccccc1 |
| InChI | InChI=1S/C26H35N5O2S/c1-32-23-10-6-9-21(25(23)33-2)24(30-15-12-20(13-16-30)22(27)14-18-34)26(28)31(29)17-11-19-7-4-3-5-8-19/h3-10,14,18,20,24,28H,11-13,15-17,27,29H2,1-2H3/b22-14-,28-26- |
| InChIKey | HRQFDSSNQKRJLG-XTNYINNTSA-N |
| XLogP | 3.69 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|