C28H41N5O3 — CID 156796292
diazene;2-(2,3-dimethoxyphenyl)-2-(3,3-dimethyl-2-oxa-8-azaspiro[4.5]decan-8-yl)-N'-(2-phenylethyl)ethanimidamide (PubChem CID 156796292) has the molecular formula C28H41N5O3 and a molecular weight of 495.67 g/mol. Its IUPAC name is diazene;2-(2,3-dimethoxyphenyl)-2-(3,3-dimethyl-2-oxa-8-azaspiro[4.5]decan-8-yl)-N'-(2-phenylethyl)ethanimidamide.
| Compound Name | diazene;2-(2,3-dimethoxyphenyl)-2-(3,3-dimethyl-2-oxa-8-azaspiro[4.5]decan-8-yl)-N'-(2-phenylethyl)ethanimidamide |
|---|---|
| PubChem CID | 156796292 |
| Molecular Formula | C28H41N5O3 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | diazene;2-(2,3-dimethoxyphenyl)-2-(3,3-dimethyl-2-oxa-8-azaspiro[4.5]decan-8-yl)-N'-(2-phenylethyl)ethanimidamide |
| SMILES | COc1cccc(C(/C(N)=N/CCc2ccccc2)N2CCC3(CC2)COC(C)(C)C3)c1OC.[H]/N=N/[H] |
| InChI | InChI=1S/C28H39N3O3.H2N2/c1-27(2)19-28(20-34-27)14-17-31(18-15-28)24(22-11-8-12-23(32-3)25(22)33-4)26(29)30-16-13-21-9-6-5-7-10-21;1-2/h5-12,24H,13-20H2,1-4H3,(H2,29,30);1-2H/b;2-1+ |
| InChIKey | XUIGXLOBWWRFJS-WLHGVMLRSA-N |
| XLogP | 5.22 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|