C27H38N4O4 — CID 156796094
2-(2,3-dimethoxyphenyl)-2-[4-(2-methoxy-2-methylpropanoyl)piperazin-1-yl]-N'-(2-phenylethyl)ethanimidamide (PubChem CID 156796094) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-2-[4-(2-methoxy-2-methylpropanoyl)piperazin-1-yl]-N'-(2-phenylethyl)ethanimidamide.
| Compound Name | 2-(2,3-dimethoxyphenyl)-2-[4-(2-methoxy-2-methylpropanoyl)piperazin-1-yl]-N'-(2-phenylethyl)ethanimidamide |
|---|---|
| PubChem CID | 156796094 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-2-[4-(2-methoxy-2-methylpropanoyl)piperazin-1-yl]-N'-(2-phenylethyl)ethanimidamide |
| SMILES | COc1cccc(C(/C(N)=N/CCc2ccccc2)N2CCN(C(=O)C(C)(C)OC)CC2)c1OC |
| InChI | InChI=1S/C27H38N4O4/c1-27(2,35-5)26(32)31-18-16-30(17-19-31)23(21-12-9-13-22(33-3)24(21)34-4)25(28)29-15-14-20-10-7-6-8-11-20/h6-13,23H,14-19H2,1-5H3,(H2,28,29) |
| InChIKey | DTHZVFXXBGICAC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|