C26H22ClFN7O2- — CID 156797250
[4-[3-chloro-4-[(6-fluoro-2-pyridinyl)methoxy]anilino]pyrido[3,2-d]pyrimidin-6-yl]-(1-prop-2-enoylpyrrolidin-3-yl)azanide (PubChem CID 156797250) has the molecular formula C26H22ClFN7O2- and a molecular weight of 518.96 g/mol. Its IUPAC name is [4-[3-chloro-4-[(6-fluoro-2-pyridinyl)methoxy]anilino]pyrido[3,2-d]pyrimidin-6-yl]-(1-prop-2-enoylpyrrolidin-3-yl)azanide.
| Compound Name | [4-[3-chloro-4-[(6-fluoro-2-pyridinyl)methoxy]anilino]pyrido[3,2-d]pyrimidin-6-yl]-(1-prop-2-enoylpyrrolidin-3-yl)azanide |
|---|---|
| PubChem CID | 156797250 |
| Molecular Formula | C26H22ClFN7O2- |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | [4-[3-chloro-4-[(6-fluoro-2-pyridinyl)methoxy]anilino]pyrido[3,2-d]pyrimidin-6-yl]-(1-prop-2-enoylpyrrolidin-3-yl)azanide |
| SMILES | C=CC(=O)N1CCC([N-]c2ccc3ncnc(Nc4ccc(OCc5cccc(F)n5)c(Cl)c4)c3n2)C1 |
| InChI | InChI=1S/C26H22ClFN7O2/c1-2-24(36)35-11-10-17(13-35)32-23-9-7-20-25(34-23)26(30-15-29-20)33-16-6-8-21(19(27)12-16)37-14-18-4-3-5-22(28)31-18/h2-9,12,15,17H,1,10-11,13-14H2,(H-,29,30,32,33,34)/q-1 |
| InChIKey | DLZDCRLEYFLRJD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|