C60H120N2O2 — CID 156799399
3-butylnonan-2-one;N'-[1-(3-butylnon-1-en-2-yloxy)icosan-10-yl]-N'-dec-1-en-2-yl-N-methylpropane-1,3-diamine (PubChem CID 156799399) has the molecular formula C60H120N2O2 and a molecular weight of 901.63 g/mol. Its IUPAC name is 3-butylnonan-2-one;N'-[1-(3-butylnon-1-en-2-yloxy)icosan-10-yl]-N'-dec-1-en-2-yl-N-methylpropane-1,3-diamine.
| Compound Name | 3-butylnonan-2-one;N'-[1-(3-butylnon-1-en-2-yloxy)icosan-10-yl]-N'-dec-1-en-2-yl-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 156799399 |
| Molecular Formula | C60H120N2O2 |
| Molecular Weight | 901.63 g/mol |
| Exact Mass | 900.93 |
| IUPAC Name | 3-butylnonan-2-one;N'-[1-(3-butylnon-1-en-2-yloxy)icosan-10-yl]-N'-dec-1-en-2-yl-N-methylpropane-1,3-diamine |
| SMILES | C=C(OCCCCCCCCCC(CCCCCCCCCC)N(CCCNC)C(=C)CCCCCCCC)C(CCCC)CCCCCC.CCCCCCC(CCCC)C(C)=O |
| InChI | InChI=1S/C47H94N2O.C13H26O/c1-8-12-16-19-21-23-27-32-39-47(49(42-35-41-48-7)44(5)36-30-26-20-17-13-9-2)40-33-28-24-22-25-29-34-43-50-45(6)46(37-15-11-4)38-31-18-14-10-3;1-4-6-8-9-11-13(12(3)14)10-7-5-2/h46-48H,5-6,8-43H2,1-4,7H3;13H,4-11H2,1-3H3 |
| InChIKey | SNTAKNCBOURYMX-UHFFFAOYSA-N |
| XLogP | 19.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.63 |
| LogP ≤ 5 | 19.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|