C11H14ClF5N2O — CID 156800125
5-(chloromethyl)-3-(7,7,8,8,8-pentafluorooctyl)-1,2,4-oxadiazole (PubChem CID 156800125) has the molecular formula C11H14ClF5N2O and a molecular weight of 320.69 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(7,7,8,8,8-pentafluorooctyl)-1,2,4-oxadiazole.
| Compound Name | 5-(chloromethyl)-3-(7,7,8,8,8-pentafluorooctyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 156800125 |
| Molecular Formula | C11H14ClF5N2O |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 5-(chloromethyl)-3-(7,7,8,8,8-pentafluorooctyl)-1,2,4-oxadiazole |
| SMILES | FC(F)(F)C(F)(F)CCCCCCc1noc(CCl)n1 |
| InChI | InChI=1S/C11H14ClF5N2O/c12-7-9-18-8(19-20-9)5-3-1-2-4-6-10(13,14)11(15,16)17/h1-7H2 |
| InChIKey | UDLJKQRAVKBKFU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|