C14H7ClN2S — CID 156801307
7-chloro-[1]benzothiolo[3,2-b]quinoxaline (PubChem CID 156801307) has the molecular formula C14H7ClN2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 7-chloro-[1]benzothiolo[3,2-b]quinoxaline.
| Compound Name | 7-chloro-[1]benzothiolo[3,2-b]quinoxaline |
|---|---|
| PubChem CID | 156801307 |
| Molecular Formula | C14H7ClN2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 7-chloro-[1]benzothiolo[3,2-b]quinoxaline |
| SMILES | Clc1cccc2nc3c(nc12)sc1ccccc13 |
| InChI | InChI=1S/C14H7ClN2S/c15-9-5-3-6-10-13(9)17-14-12(16-10)8-4-1-2-7-11(8)18-14/h1-7H |
| InChIKey | IXTMAVPOOOSDKK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |