C11H5Cl2NS — CID 12580094
3,4-dichloro-[1]benzothiolo[2,3-b]pyridine (PubChem CID 12580094) has the molecular formula C11H5Cl2NS and a molecular weight of 254.14 g/mol. Its IUPAC name is 3,4-dichloro-[1]benzothiolo[2,3-b]pyridine.
| Compound Name | 3,4-dichloro-[1]benzothiolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 12580094 |
| Molecular Formula | C11H5Cl2NS |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | 3,4-dichloro-[1]benzothiolo[2,3-b]pyridine |
| SMILES | Clc1cnc2sc3ccccc3c2c1Cl |
| InChI | InChI=1S/C11H5Cl2NS/c12-7-5-14-11-9(10(7)13)6-3-1-2-4-8(6)15-11/h1-5H |
| InChIKey | FGTVSBFEZPIGBG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |