About 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane
6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane (PubChem CID 156801749) has the molecular formula C11H16BrN5
and a molecular weight of 298.19 g/mol. Its IUPAC name is 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane.
Molecular Properties
| Compound Name | 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane |
| PubChem CID | 156801749 |
| Molecular Formula | C11H16BrN5 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane |
| SMILES | Brc1cccc(NCCn2cncn2)n1.CC |
| InChI | InChI=1S/C9H10BrN5.C2H6/c10-8-2-1-3-9(14-8)12-4-5-15-7-11-6-13-15;1-2/h1-3,6-7H,4-5H2,(H,12,14);1-2H3 |
| InChIKey | WBFMXCAWTNPHJI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane?
The IUPAC name of 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane (CID 156801749) is 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane.
What is the SMILES notation for 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane?
The canonical SMILES for 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane is Brc1cccc(NCCn2cncn2)n1.CC.
What is the InChIKey of 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane?
The InChIKey is WBFMXCAWTNPHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN5.C2H6/c10-8-2-1-3-9(14-8)12-4-5-15-7-11-6-13-15;1-2/h1-3,6-7H,4-5H2,(H,12,14);1-2H3.
What are the key properties of 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane?
6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane has a molecular weight of 298.19 g/mol, XLogP of 2.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine;ethane is sourced from PubChem (CID 156801749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).